C11H16Cl3N3O — CID 119632894
[2-(aminomethyl)pyrrolidin-1-yl]-(3-chloro-4-pyridinyl)methanone;dihydrochloride (PubChem CID 119632894) has the molecular formula C11H16Cl3N3O and a molecular weight of 312.63 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-(3-chloro-4-pyridinyl)methanone;dihydrochloride.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-(3-chloro-4-pyridinyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119632894 |
| Molecular Formula | C11H16Cl3N3O |
| Molecular Weight | 312.63 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-(3-chloro-4-pyridinyl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCCN1C(=O)c1ccncc1Cl |
| InChI | InChI=1S/C11H14ClN3O.2ClH/c12-10-7-14-4-3-9(10)11(16)15-5-1-2-8(15)6-13;;/h3-4,7-8H,1-2,5-6,13H2;2*1H |
| InChIKey | XJWDKHORCCKYEH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.63 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |