C13H16Cl2N2O — CID 66472291
[2-(3-chloropropyl)pyrrolidin-1-yl]-(3-chloro-4-pyridinyl)methanone (PubChem CID 66472291) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is [2-(3-chloropropyl)pyrrolidin-1-yl]-(3-chloro-4-pyridinyl)methanone.
| Compound Name | [2-(3-chloropropyl)pyrrolidin-1-yl]-(3-chloro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 66472291 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | [2-(3-chloropropyl)pyrrolidin-1-yl]-(3-chloro-4-pyridinyl)methanone |
| SMILES | O=C(c1ccncc1Cl)N1CCCC1CCCCl |
| InChI | InChI=1S/C13H16Cl2N2O/c14-6-1-3-10-4-2-8-17(10)13(18)11-5-7-16-9-12(11)15/h5,7,9-10H,1-4,6,8H2 |
| InChIKey | IMNSODQQNKQLFM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|