C13H15F2NO3 — CID 43391804
[2-(difluoromethoxy)phenyl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 43391804) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is [2-(difluoromethoxy)phenyl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [2-(difluoromethoxy)phenyl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 43391804 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [2-(difluoromethoxy)phenyl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1ccccc1OC(F)F)N1CCC(O)CC1 |
| InChI | InChI=1S/C13H15F2NO3/c14-13(15)19-11-4-2-1-3-10(11)12(18)16-7-5-9(17)6-8-16/h1-4,9,13,17H,5-8H2 |
| InChIKey | DFSKNWSSGAVAHO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |