C18H23F2N3O3 — CID 119278778
[4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-piperidin-2-ylmethanone (PubChem CID 119278778) has the molecular formula C18H23F2N3O3 and a molecular weight of 367.40 g/mol. Its IUPAC name is [4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-piperidin-2-ylmethanone.
| Compound Name | [4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-piperidin-2-ylmethanone |
|---|---|
| PubChem CID | 119278778 |
| Molecular Formula | C18H23F2N3O3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [4-[2-(difluoromethoxy)benzoyl]piperazin-1-yl]-piperidin-2-ylmethanone |
| SMILES | O=C(c1ccccc1OC(F)F)N1CCN(C(=O)C2CCCCN2)CC1 |
| InChI | InChI=1S/C18H23F2N3O3/c19-18(20)26-15-7-2-1-5-13(15)16(24)22-9-11-23(12-10-22)17(25)14-6-3-4-8-21-14/h1-2,5,7,14,18,21H,3-4,6,8-12H2 |
| InChIKey | DBRGEACMNDDTLL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |