C19H21FN2O — CID 16626258
1-(2-cyclohexylimino-1-pyridinyl)-2-(2-fluorophenyl)ethanone (PubChem CID 16626258) has the molecular formula C19H21FN2O and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-(2-cyclohexylimino-1-pyridinyl)-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-(2-cyclohexylimino-1-pyridinyl)-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 16626258 |
| Molecular Formula | C19H21FN2O |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-(2-cyclohexylimino-1-pyridinyl)-2-(2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1F)n1cccc/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C19H21FN2O/c20-17-11-5-4-8-15(17)14-19(23)22-13-7-6-12-18(22)21-16-9-2-1-3-10-16/h4-8,11-13,16H,1-3,9-10,14H2/b21-18+ |
| InChIKey | JXIOBECXAPXYIP-DYTRJAOYSA-N |
| XLogP | 3.74 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |