C14H18FNO — CID 110671110
1-(2-ethylpyrrolidin-1-yl)-2-(2-fluorophenyl)ethanone (PubChem CID 110671110) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 1-(2-ethylpyrrolidin-1-yl)-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-(2-ethylpyrrolidin-1-yl)-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 110671110 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-(2-ethylpyrrolidin-1-yl)-2-(2-fluorophenyl)ethanone |
| SMILES | CCC1CCCN1C(=O)Cc1ccccc1F |
| InChI | InChI=1S/C14H18FNO/c1-2-12-7-5-9-16(12)14(17)10-11-6-3-4-8-13(11)15/h3-4,6,8,12H,2,5,7,9-10H2,1H3 |
| InChIKey | CGHJXCWAKPWVGB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |