C22H31FN2O2 — CID 109148363
4-(2-ethylpiperidine-1-carbonyl)-N-[(2-fluorophenyl)methyl]cyclohexane-1-carboxamide (PubChem CID 109148363) has the molecular formula C22H31FN2O2 and a molecular weight of 374.50 g/mol. Its IUPAC name is 4-(2-ethylpiperidine-1-carbonyl)-N-[(2-fluorophenyl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(2-ethylpiperidine-1-carbonyl)-N-[(2-fluorophenyl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109148363 |
| Molecular Formula | C22H31FN2O2 |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 4-(2-ethylpiperidine-1-carbonyl)-N-[(2-fluorophenyl)methyl]cyclohexane-1-carboxamide |
| SMILES | CCC1CCCCN1C(=O)C1CCC(C(=O)NCc2ccccc2F)CC1 |
| InChI | InChI=1S/C22H31FN2O2/c1-2-19-8-5-6-14-25(19)22(27)17-12-10-16(11-13-17)21(26)24-15-18-7-3-4-9-20(18)23/h3-4,7,9,16-17,19H,2,5-6,8,10-15H2,1H3,(H,24,26) |
| InChIKey | KZGQTQHHYHNBIW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |