C16H22FNO3S — CID 86989421
1-(2-ethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylsulfonyl]ethanone (PubChem CID 86989421) has the molecular formula C16H22FNO3S and a molecular weight of 327.42 g/mol. Its IUPAC name is 1-(2-ethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylsulfonyl]ethanone.
| Compound Name | 1-(2-ethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylsulfonyl]ethanone |
|---|---|
| PubChem CID | 86989421 |
| Molecular Formula | C16H22FNO3S |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-(2-ethylpiperidin-1-yl)-2-[(2-fluorophenyl)methylsulfonyl]ethanone |
| SMILES | CCC1CCCCN1C(=O)CS(=O)(=O)Cc1ccccc1F |
| InChI | InChI=1S/C16H22FNO3S/c1-2-14-8-5-6-10-18(14)16(19)12-22(20,21)11-13-7-3-4-9-15(13)17/h3-4,7,9,14H,2,5-6,8,10-12H2,1H3 |
| InChIKey | VXHCKMXYTBLOCC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |