C14H21N3O3S — CID 167772224
1-(2-ethylpiperidin-1-yl)-2-(pyrimidin-2-ylmethylsulfonyl)ethanone (PubChem CID 167772224) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-(2-ethylpiperidin-1-yl)-2-(pyrimidin-2-ylmethylsulfonyl)ethanone.
| Compound Name | 1-(2-ethylpiperidin-1-yl)-2-(pyrimidin-2-ylmethylsulfonyl)ethanone |
|---|---|
| PubChem CID | 167772224 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-(2-ethylpiperidin-1-yl)-2-(pyrimidin-2-ylmethylsulfonyl)ethanone |
| SMILES | CCC1CCCCN1C(=O)CS(=O)(=O)Cc1ncccn1 |
| InChI | InChI=1S/C14H21N3O3S/c1-2-12-6-3-4-9-17(12)14(18)11-21(19,20)10-13-15-7-5-8-16-13/h5,7-8,12H,2-4,6,9-11H2,1H3 |
| InChIKey | UDCWCUWWGKPJIJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |