C18H27FN2O4S — CID 71631754
tert-butyl 2-[[(2-fluorophenyl)methylsulfonylamino]methyl]piperidine-1-carboxylate (PubChem CID 71631754) has the molecular formula C18H27FN2O4S and a molecular weight of 386.49 g/mol. Its IUPAC name is tert-butyl 2-[[(2-fluorophenyl)methylsulfonylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(2-fluorophenyl)methylsulfonylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71631754 |
| Molecular Formula | C18H27FN2O4S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | tert-butyl 2-[[(2-fluorophenyl)methylsulfonylamino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CNS(=O)(=O)Cc1ccccc1F |
| InChI | InChI=1S/C18H27FN2O4S/c1-18(2,3)25-17(22)21-11-7-6-9-15(21)12-20-26(23,24)13-14-8-4-5-10-16(14)19/h4-5,8,10,15,20H,6-7,9,11-13H2,1-3H3 |
| InChIKey | BFRMWGNRWUMDPH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |