C19H25F2NO3 — CID 114058413
tert-butyl 2-[2-(2,3-difluorophenyl)-2-oxoethyl]azepane-1-carboxylate (PubChem CID 114058413) has the molecular formula C19H25F2NO3 and a molecular weight of 353.41 g/mol. Its IUPAC name is tert-butyl 2-[2-(2,3-difluorophenyl)-2-oxoethyl]azepane-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(2,3-difluorophenyl)-2-oxoethyl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 114058413 |
| Molecular Formula | C19H25F2NO3 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | tert-butyl 2-[2-(2,3-difluorophenyl)-2-oxoethyl]azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCCC1CC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C19H25F2NO3/c1-19(2,3)25-18(24)22-11-6-4-5-8-13(22)12-16(23)14-9-7-10-15(20)17(14)21/h7,9-10,13H,4-6,8,11-12H2,1-3H3 |
| InChIKey | DPCWNIOEBHBQSS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |