C16H21N — CID 150295309
9-benzylidene-1,2,3,4,6,7,8,9a-octahydroquinolizine (PubChem CID 150295309) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 9-benzylidene-1,2,3,4,6,7,8,9a-octahydroquinolizine.
| Compound Name | 9-benzylidene-1,2,3,4,6,7,8,9a-octahydroquinolizine |
|---|---|
| PubChem CID | 150295309 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 9-benzylidene-1,2,3,4,6,7,8,9a-octahydroquinolizine |
| SMILES | C(=C1CCCN2CCCCC12)c1ccccc1 |
| InChI | InChI=1S/C16H21N/c1-2-7-14(8-3-1)13-15-9-6-12-17-11-5-4-10-16(15)17/h1-3,7-8,13,16H,4-6,9-12H2 |
| InChIKey | GILRXRZPHJCMGF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |