C17H22 — CID 13164040
(8E)-8-benzylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene (PubChem CID 13164040) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is (8E)-8-benzylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene.
| Compound Name | (8E)-8-benzylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 13164040 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (8E)-8-benzylidene-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene |
| SMILES | C(=C1\CCCC2CCCCC12)\c1ccccc1 |
| InChI | InChI=1S/C17H22/c1-2-7-14(8-3-1)13-16-11-6-10-15-9-4-5-12-17(15)16/h1-3,7-8,13,15,17H,4-6,9-12H2/b16-13+ |
| InChIKey | JFDDWRVVNHDRMH-DTQAZKPQSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |