C19H18O — CID 12642987
(2E,5E)-2,5-dibenzylidenecyclopentan-1-ol (PubChem CID 12642987) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is (2E,5E)-2,5-dibenzylidenecyclopentan-1-ol.
| Compound Name | (2E,5E)-2,5-dibenzylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 12642987 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (2E,5E)-2,5-dibenzylidenecyclopentan-1-ol |
| SMILES | OC1/C(=C/c2ccccc2)CC/C1=C\c1ccccc1 |
| InChI | InChI=1S/C19H18O/c20-19-17(13-15-7-3-1-4-8-15)11-12-18(19)14-16-9-5-2-6-10-16/h1-10,13-14,19-20H,11-12H2/b17-13+,18-14+ |
| InChIKey | VEOYGZUKUUMVDQ-HBKJEHTGSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |