C21H22N2S — CID 11938660
(4S,4aS,8E,8aR)-8-benzylidene-4-phenyl-1,3,4,4a,5,6,7,8a-octahydroquinazoline-2-thione (PubChem CID 11938660) has the molecular formula C21H22N2S and a molecular weight of 334.49 g/mol. Its IUPAC name is (4S,4aS,8E,8aR)-8-benzylidene-4-phenyl-1,3,4,4a,5,6,7,8a-octahydroquinazoline-2-thione.
| Compound Name | (4S,4aS,8E,8aR)-8-benzylidene-4-phenyl-1,3,4,4a,5,6,7,8a-octahydroquinazoline-2-thione |
|---|---|
| PubChem CID | 11938660 |
| Molecular Formula | C21H22N2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (4S,4aS,8E,8aR)-8-benzylidene-4-phenyl-1,3,4,4a,5,6,7,8a-octahydroquinazoline-2-thione |
| SMILES | S=C1N[C@H](c2ccccc2)[C@H]2CCC/C(=C\c3ccccc3)[C@@H]2N1 |
| InChI | InChI=1S/C21H22N2S/c24-21-22-19(16-10-5-2-6-11-16)18-13-7-12-17(20(18)23-21)14-15-8-3-1-4-9-15/h1-6,8-11,14,18-20H,7,12-13H2,(H2,22,23,24)/b17-14+/t18-,19-,20+/m1/s1 |
| InChIKey | GKAOLMKVJJNZGU-RZKDKQSUSA-N |
| XLogP | 4.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|