C14H15NO — CID 12032725
(1E)-1-benzylidene-5,6,7,8-tetrahydropyrrolizin-3-one (PubChem CID 12032725) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is (1E)-1-benzylidene-5,6,7,8-tetrahydropyrrolizin-3-one.
| Compound Name | (1E)-1-benzylidene-5,6,7,8-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 12032725 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (1E)-1-benzylidene-5,6,7,8-tetrahydropyrrolizin-3-one |
| SMILES | O=C1C/C(=C\c2ccccc2)C2CCCN12 |
| InChI | InChI=1S/C14H15NO/c16-14-10-12(13-7-4-8-15(13)14)9-11-5-2-1-3-6-11/h1-3,5-6,9,13H,4,7-8,10H2/b12-9+ |
| InChIKey | OGMVBVNWXXLYGD-FMIVXFBMSA-N |
| XLogP | 2.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |