C15H13NO2S — CID 10707261
(3S)-17-thia-7-azatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),11,13,15-tetraene-2,8-dione (PubChem CID 10707261) has the molecular formula C15H13NO2S and a molecular weight of 271.34 g/mol. Its IUPAC name is (3S)-17-thia-7-azatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),11,13,15-tetraene-2,8-dione.
| Compound Name | (3S)-17-thia-7-azatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),11,13,15-tetraene-2,8-dione |
|---|---|
| PubChem CID | 10707261 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | (3S)-17-thia-7-azatetracyclo[8.7.0.03,7.011,16]heptadeca-1(10),11,13,15-tetraene-2,8-dione |
| SMILES | O=C1c2sc3ccccc3c2CC(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C15H13NO2S/c17-13-8-10-9-4-1-2-6-12(9)19-15(10)14(18)11-5-3-7-16(11)13/h1-2,4,6,11H,3,5,7-8H2/t11-/m0/s1 |
| InChIKey | DDHLPIBOZPNAPH-NSHDSACASA-N |
| XLogP | 2.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |