C15H15NOS — CID 7720823
(6aS)-6a,7,8,9,10,12-hexahydro-[1]benzothiolo[2,3-b]quinolizin-6-one (PubChem CID 7720823) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is (6aS)-6a,7,8,9,10,12-hexahydro-[1]benzothiolo[2,3-b]quinolizin-6-one.
| Compound Name | (6aS)-6a,7,8,9,10,12-hexahydro-[1]benzothiolo[2,3-b]quinolizin-6-one |
|---|---|
| PubChem CID | 7720823 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (6aS)-6a,7,8,9,10,12-hexahydro-[1]benzothiolo[2,3-b]quinolizin-6-one |
| SMILES | O=C1c2sc3ccccc3c2CN2CCCC[C@@H]12 |
| InChI | InChI=1S/C15H15NOS/c17-14-12-6-3-4-8-16(12)9-11-10-5-1-2-7-13(10)18-15(11)14/h1-2,5,7,12H,3-4,6,8-9H2/t12-/m0/s1 |
| InChIKey | BPYOVRFNYCOZTJ-LBPRGKRZSA-N |
| XLogP | 3.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |