C17H19N3O — CID 10540789
6a,7,8,9,10,12-hexahydro-6H-quinolino[2,3-b]quinolizine-13-carboxamide (PubChem CID 10540789) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 6a,7,8,9,10,12-hexahydro-6H-quinolino[2,3-b]quinolizine-13-carboxamide.
| Compound Name | 6a,7,8,9,10,12-hexahydro-6H-quinolino[2,3-b]quinolizine-13-carboxamide |
|---|---|
| PubChem CID | 10540789 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 6a,7,8,9,10,12-hexahydro-6H-quinolino[2,3-b]quinolizine-13-carboxamide |
| SMILES | NC(=O)c1c2c(nc3ccccc13)CC1CCCCN1C2 |
| InChI | InChI=1S/C17H19N3O/c18-17(21)16-12-6-1-2-7-14(12)19-15-9-11-5-3-4-8-20(11)10-13(15)16/h1-2,6-7,11H,3-5,8-10H2,(H2,18,21) |
| InChIKey | LQHHICXMHFEXDL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |