C16H18N2O2 — CID 58449984
2-(1,2,3,3a,4,10-hexahydroindolizino[6,7-b]indol-9-yl)acetic acid (PubChem CID 58449984) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(1,2,3,3a,4,10-hexahydroindolizino[6,7-b]indol-9-yl)acetic acid.
| Compound Name | 2-(1,2,3,3a,4,10-hexahydroindolizino[6,7-b]indol-9-yl)acetic acid |
|---|---|
| PubChem CID | 58449984 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-(1,2,3,3a,4,10-hexahydroindolizino[6,7-b]indol-9-yl)acetic acid |
| SMILES | O=C(O)Cn1c2c(c3ccccc31)CC1CCCN1C2 |
| InChI | InChI=1S/C16H18N2O2/c19-16(20)10-18-14-6-2-1-5-12(14)13-8-11-4-3-7-17(11)9-15(13)18/h1-2,5-6,11H,3-4,7-10H2,(H,19,20) |
| InChIKey | XDGAXRZVBKUVKG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|