2-carbazol-9-ylacetic acid

C14H11NO2 — CID 2815870

IUPAC2-carbazol-9-ylacetic acid
SMILESO=C(O)Cn1c2ccccc2c2ccccc21
InChIInChI=1S/C14H11NO2/c16-14(17)9-15-12-7-3-1-5-10(12)11-6-2-4-8-13(11)15/h1-8H,9H2,(H,16,17)
InChIKeyPBDMLLFEZXXJNE-UHFFFAOYSA-N
MW225.25 g/mol
LogP2.88
Rot. Bonds2

About 2-carbazol-9-ylacetic acid

2-carbazol-9-ylacetic acid (PubChem CID 2815870) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-carbazol-9-ylacetic acid.

Molecular Properties

Compound Name2-carbazol-9-ylacetic acid
PubChem CID2815870
Molecular FormulaC14H11NO2
Molecular Weight225.25 g/mol
Exact Mass225.08
IUPAC Name2-carbazol-9-ylacetic acid
SMILESO=C(O)Cn1c2ccccc2c2ccccc21
InChIInChI=1S/C14H11NO2/c16-14(17)9-15-12-7-3-1-5-10(12)11-6-2-4-8-13(11)15/h1-8H,9H2,(H,16,17)
InChIKeyPBDMLLFEZXXJNE-UHFFFAOYSA-N
XLogP2.88
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 52.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-carbazol-9-ylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-carbazol-9-ylacetic acid?
The IUPAC name of 2-carbazol-9-ylacetic acid (CID 2815870) is 2-carbazol-9-ylacetic acid.
What is the SMILES notation for 2-carbazol-9-ylacetic acid?
The canonical SMILES for 2-carbazol-9-ylacetic acid is O=C(O)Cn1c2ccccc2c2ccccc21.
What is the InChIKey of 2-carbazol-9-ylacetic acid?
The InChIKey is PBDMLLFEZXXJNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2/c16-14(17)9-15-12-7-3-1-5-10(12)11-6-2-4-8-13(11)15/h1-8H,9H2,(H,16,17).
What are the key properties of 2-carbazol-9-ylacetic acid?
2-carbazol-9-ylacetic acid has a molecular weight of 225.25 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbazol-9-ylacetic acid is sourced from PubChem (CID 2815870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).