C13H14N2O2 — CID 131896652
(3S,8aS)-3-phenyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 131896652) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is (3S,8aS)-3-phenyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,8aS)-3-phenyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 131896652 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (3S,8aS)-3-phenyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1N[C@@H](c2ccccc2)C(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C13H14N2O2/c16-12-10-7-4-8-15(10)13(17)11(14-12)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8H2,(H,14,16)/t10-,11-/m0/s1 |
| InChIKey | KHLPKFYOHNHMPR-QWRGUYRKSA-N |
| XLogP | 0.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |