C36H42N6O6 — CID 101352496
(1R,7S,10S,13R,19S,22R,26Z)-10,22-dibenzyl-3,9,12,15,21,24-hexazatetracyclo[11.11.4.03,7.015,19]octacos-26-ene-2,8,11,14,20,23-hexone (PubChem CID 101352496) has the molecular formula C36H42N6O6 and a molecular weight of 654.77 g/mol. Its IUPAC name is (1R,7S,10S,13R,19S,22R,26Z)-10,22-dibenzyl-3,9,12,15,21,24-hexazatetracyclo[11.11.4.03,7.015,19]octacos-26-ene-2,8,11,14,20,23-hexone.
| Compound Name | (1R,7S,10S,13R,19S,22R,26Z)-10,22-dibenzyl-3,9,12,15,21,24-hexazatetracyclo[11.11.4.03,7.015,19]octacos-26-ene-2,8,11,14,20,23-hexone |
|---|---|
| PubChem CID | 101352496 |
| Molecular Formula | C36H42N6O6 |
| Molecular Weight | 654.77 g/mol |
| Exact Mass | 654.32 |
| IUPAC Name | (1R,7S,10S,13R,19S,22R,26Z)-10,22-dibenzyl-3,9,12,15,21,24-hexazatetracyclo[11.11.4.03,7.015,19]octacos-26-ene-2,8,11,14,20,23-hexone |
| SMILES | O=C1N[C@@H]2C/C=C\C[C@@H](NC(=O)[C@@H](Cc3ccccc3)NC(=O)[C@@H]3CCCN3C2=O)C(=O)N2CCC[C@H]2C(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C36H42N6O6/c43-31-27(21-23-11-3-1-4-12-23)39-33(45)29-17-9-19-41(29)36(48)26-16-8-7-15-25(37-31)35(47)42-20-10-18-30(42)34(46)40-28(32(44)38-26)22-24-13-5-2-6-14-24/h1-8,11-14,25-30H,9-10,15-22H2,(H,37,43)(H,38,44)(H,39,45)(H,40,46)/b8-7-/t25-,26-,27-,28+,29+,30+/m1/s1 |
| InChIKey | VBTHYNLBNIIBRZ-JAVQCTMQSA-N |
| XLogP | 0.76 |
| TPSA | 157.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.77 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|