C33H33F3N4O4 — CID 167160762
(3S,6R,9S,12R)-3,9-dibenzyl-6-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 167160762) has the molecular formula C33H33F3N4O4 and a molecular weight of 606.65 g/mol. Its IUPAC name is (3S,6R,9S,12R)-3,9-dibenzyl-6-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6R,9S,12R)-3,9-dibenzyl-6-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 167160762 |
| Molecular Formula | C33H33F3N4O4 |
| Molecular Weight | 606.65 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | (3S,6R,9S,12R)-3,9-dibenzyl-6-[[4-(trifluoromethyl)phenyl]methyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | O=C1N[C@H](Cc2ccc(C(F)(F)F)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N2CCC[C@@H]2C(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C33H33F3N4O4/c34-33(35,36)24-15-13-23(14-16-24)19-25-30(42)39-27(20-22-10-5-2-6-11-22)32(44)40-17-7-12-28(40)31(43)38-26(29(41)37-25)18-21-8-3-1-4-9-21/h1-6,8-11,13-16,25-28H,7,12,17-20H2,(H,37,41)(H,38,43)(H,39,42)/t25-,26+,27+,28-/m1/s1 |
| InChIKey | HVFZIWUMIVFTBV-WXIAYYLYSA-N |
| XLogP | 3.19 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |