C30H30N4O4 — CID 162815450
10,13-dibenzyl-3,9,12,15-tetrazatricyclo[14.4.0.03,7]icosa-1(20),16,18-triene-2,8,11,14-tetrone (PubChem CID 162815450) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is 10,13-dibenzyl-3,9,12,15-tetrazatricyclo[14.4.0.03,7]icosa-1(20),16,18-triene-2,8,11,14-tetrone.
| Compound Name | 10,13-dibenzyl-3,9,12,15-tetrazatricyclo[14.4.0.03,7]icosa-1(20),16,18-triene-2,8,11,14-tetrone |
|---|---|
| PubChem CID | 162815450 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 10,13-dibenzyl-3,9,12,15-tetrazatricyclo[14.4.0.03,7]icosa-1(20),16,18-triene-2,8,11,14-tetrone |
| SMILES | O=C1Nc2ccccc2C(=O)N2CCCC2C(=O)NC(Cc2ccccc2)C(=O)NC1Cc1ccccc1 |
| InChI | InChI=1S/C30H30N4O4/c35-27-24(18-20-10-3-1-4-11-20)32-28(36)25(19-21-12-5-2-6-13-21)33-29(37)26-16-9-17-34(26)30(38)22-14-7-8-15-23(22)31-27/h1-8,10-15,24-26H,9,16-19H2,(H,31,35)(H,32,36)(H,33,37) |
| InChIKey | CLGTZBGSAHDAKP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |