C31H39N5O5 — CID 177446429
(7S,10R,13R,16S)-10-benzyl-9,13-dimethyl-16-(2-methylpropyl)-3,9,12,15,18-pentazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-triene-2,8,11,14,17-pentone (PubChem CID 177446429) has the molecular formula C31H39N5O5 and a molecular weight of 561.68 g/mol. Its IUPAC name is (7S,10R,13R,16S)-10-benzyl-9,13-dimethyl-16-(2-methylpropyl)-3,9,12,15,18-pentazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-triene-2,8,11,14,17-pentone.
| Compound Name | (7S,10R,13R,16S)-10-benzyl-9,13-dimethyl-16-(2-methylpropyl)-3,9,12,15,18-pentazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-triene-2,8,11,14,17-pentone |
|---|---|
| PubChem CID | 177446429 |
| Molecular Formula | C31H39N5O5 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | (7S,10R,13R,16S)-10-benzyl-9,13-dimethyl-16-(2-methylpropyl)-3,9,12,15,18-pentazatricyclo[17.4.0.03,7]tricosa-1(23),19,21-triene-2,8,11,14,17-pentone |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@@H](Cc2ccccc2)N(C)C(=O)[C@@H]2CCCN2C(=O)c2ccccc2NC1=O |
| InChI | InChI=1S/C31H39N5O5/c1-19(2)17-24-28(38)33-23-14-9-8-13-22(23)30(40)36-16-10-15-25(36)31(41)35(4)26(18-21-11-6-5-7-12-21)29(39)32-20(3)27(37)34-24/h5-9,11-14,19-20,24-26H,10,15-18H2,1-4H3,(H,32,39)(H,33,38)(H,34,37)/t20-,24+,25+,26-/m1/s1 |
| InChIKey | ZAOLUKZYYZGPOH-IFKAHUTRSA-N |
| XLogP | 2.35 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |