C15H14N2O — CID 69170417
[6-(2-phenylethenyl)cyclohexa-2,4-dien-1-ylidene]urea (PubChem CID 69170417) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is [6-(2-phenylethenyl)cyclohexa-2,4-dien-1-ylidene]urea.
| Compound Name | [6-(2-phenylethenyl)cyclohexa-2,4-dien-1-ylidene]urea |
|---|---|
| PubChem CID | 69170417 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | [6-(2-phenylethenyl)cyclohexa-2,4-dien-1-ylidene]urea |
| SMILES | NC(=O)N=C1C=CC=CC1C=Cc1ccccc1 |
| InChI | InChI=1S/C15H14N2O/c16-15(18)17-14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12/h1-11,13H,(H2,16,18) |
| InChIKey | PVXBGRMMYUWKAP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|