C22H18OPd — CID 175249285
1-(6-benzylidenecyclohexa-2,4-dien-1-yl)-3-phenylprop-2-en-1-one;palladium (PubChem CID 175249285) has the molecular formula C22H18OPd and a molecular weight of 404.81 g/mol. Its IUPAC name is 1-(6-benzylidenecyclohexa-2,4-dien-1-yl)-3-phenylprop-2-en-1-one;palladium.
| Compound Name | 1-(6-benzylidenecyclohexa-2,4-dien-1-yl)-3-phenylprop-2-en-1-one;palladium |
|---|---|
| PubChem CID | 175249285 |
| Molecular Formula | C22H18OPd |
| Molecular Weight | 404.81 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 1-(6-benzylidenecyclohexa-2,4-dien-1-yl)-3-phenylprop-2-en-1-one;palladium |
| SMILES | O=C(C=Cc1ccccc1)C1C=CC=CC1=Cc1ccccc1.[Pd] |
| InChI | InChI=1S/C22H18O.Pd/c23-22(16-15-18-9-3-1-4-10-18)21-14-8-7-13-20(21)17-19-11-5-2-6-12-19;/h1-17,21H; |
| InChIKey | HJNOCFWXEMKOPT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.81 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|