C17H18ClN — CID 70264914
N-(3-chloropropyl)-6-(2-phenylethenyl)cyclohexa-2,4-dien-1-imine (PubChem CID 70264914) has the molecular formula C17H18ClN and a molecular weight of 271.79 g/mol. Its IUPAC name is N-(3-chloropropyl)-6-(2-phenylethenyl)cyclohexa-2,4-dien-1-imine.
| Compound Name | N-(3-chloropropyl)-6-(2-phenylethenyl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 70264914 |
| Molecular Formula | C17H18ClN |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-(3-chloropropyl)-6-(2-phenylethenyl)cyclohexa-2,4-dien-1-imine |
| SMILES | ClCCC/N=C1\C=CC=CC1C=Cc1ccccc1 |
| InChI | InChI=1S/C17H18ClN/c18-13-6-14-19-17-10-5-4-9-16(17)12-11-15-7-2-1-3-8-15/h1-5,7-12,16H,6,13-14H2/b12-11?,19-17+ |
| InChIKey | UIHFVNJKYJIELA-BGZCKNQKSA-N |
| XLogP | 4.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|