C14H19N — CID 97289892
(2R)-2-[(Z)-2-phenylethenyl]azepane (PubChem CID 97289892) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (2R)-2-[(Z)-2-phenylethenyl]azepane.
| Compound Name | (2R)-2-[(Z)-2-phenylethenyl]azepane |
|---|---|
| PubChem CID | 97289892 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (2R)-2-[(Z)-2-phenylethenyl]azepane |
| SMILES | C(=C\[C@H]1CCCCCN1)\c1ccccc1 |
| InChI | InChI=1S/C14H19N/c1-3-7-13(8-4-1)10-11-14-9-5-2-6-12-15-14/h1,3-4,7-8,10-11,14-15H,2,5-6,9,12H2/b11-10-/t14-/m1/s1 |
| InChIKey | DGEGHBUXYDGKJU-IWMPZKFUSA-N |
| XLogP | 3.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |