C17H25N — CID 114239669
2-[(E)-2-(3,5-dimethylphenyl)ethenyl]azocane (PubChem CID 114239669) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-[(E)-2-(3,5-dimethylphenyl)ethenyl]azocane.
| Compound Name | 2-[(E)-2-(3,5-dimethylphenyl)ethenyl]azocane |
|---|---|
| PubChem CID | 114239669 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 2-[(E)-2-(3,5-dimethylphenyl)ethenyl]azocane |
| SMILES | Cc1cc(C)cc(/C=C/C2CCCCCCN2)c1 |
| InChI | InChI=1S/C17H25N/c1-14-11-15(2)13-16(12-14)8-9-17-7-5-3-4-6-10-18-17/h8-9,11-13,17-18H,3-7,10H2,1-2H3/b9-8+ |
| InChIKey | CCICCZVFYXCHSW-CMDGGOBGSA-N |
| XLogP | 4.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |