C15H20 — CID 22325167
[(E)-3-cyclohexylprop-1-enyl]benzene (PubChem CID 22325167) has the molecular formula C15H20 and a molecular weight of 200.33 g/mol. Its IUPAC name is [(E)-3-cyclohexylprop-1-enyl]benzene.
| Compound Name | [(E)-3-cyclohexylprop-1-enyl]benzene |
|---|---|
| PubChem CID | 22325167 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | [(E)-3-cyclohexylprop-1-enyl]benzene |
| SMILES | C(=C/c1ccccc1)\CC1CCCCC1 |
| InChI | InChI=1S/C15H20/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15/h1,3-4,7-9,12,15H,2,5-6,10-11,13H2/b12-7+ |
| InChIKey | BKUGRLZRWNIOGC-KPKJPENVSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |