About 5-cyclopropylpent-1-enylbenzene;styrene
5-cyclopropylpent-1-enylbenzene;styrene (PubChem CID 173204753) has the molecular formula C22H26
and a molecular weight of 290.45 g/mol. Its IUPAC name is 5-cyclopropylpent-1-enylbenzene;styrene.
Molecular Properties
| Compound Name | 5-cyclopropylpent-1-enylbenzene;styrene |
| PubChem CID | 173204753 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 5-cyclopropylpent-1-enylbenzene;styrene |
| SMILES | C(=Cc1ccccc1)CCCC1CC1.C=Cc1ccccc1 |
| InChI | InChI=1S/C14H18.C8H8/c1-3-7-13(8-4-1)9-5-2-6-10-14-11-12-14;1-2-8-6-4-3-5-7-8/h1,3-5,7-9,14H,2,6,10-12H2;2-7H,1H2 |
| InChIKey | CEBTYGVCTIASAW-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopropylpent-1-enylbenzene;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropylpent-1-enylbenzene;styrene?
The IUPAC name of 5-cyclopropylpent-1-enylbenzene;styrene (CID 173204753) is 5-cyclopropylpent-1-enylbenzene;styrene.
What is the SMILES notation for 5-cyclopropylpent-1-enylbenzene;styrene?
The canonical SMILES for 5-cyclopropylpent-1-enylbenzene;styrene is C(=Cc1ccccc1)CCCC1CC1.C=Cc1ccccc1.
What is the InChIKey of 5-cyclopropylpent-1-enylbenzene;styrene?
The InChIKey is CEBTYGVCTIASAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18.C8H8/c1-3-7-13(8-4-1)9-5-2-6-10-14-11-12-14;1-2-8-6-4-3-5-7-8/h1,3-5,7-9,14H,2,6,10-12H2;2-7H,1H2.
What are the key properties of 5-cyclopropylpent-1-enylbenzene;styrene?
5-cyclopropylpent-1-enylbenzene;styrene has a molecular weight of 290.45 g/mol, XLogP of 6.61, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropylpent-1-enylbenzene;styrene is sourced from PubChem (CID 173204753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).