C15H21N — CID 54044931
(2R,4R)-1,2-dimethyl-4-[(E)-3-phenylprop-2-enyl]pyrrolidine (PubChem CID 54044931) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (2R,4R)-1,2-dimethyl-4-[(E)-3-phenylprop-2-enyl]pyrrolidine.
| Compound Name | (2R,4R)-1,2-dimethyl-4-[(E)-3-phenylprop-2-enyl]pyrrolidine |
|---|---|
| PubChem CID | 54044931 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (2R,4R)-1,2-dimethyl-4-[(E)-3-phenylprop-2-enyl]pyrrolidine |
| SMILES | C[C@@H]1C[C@@H](C/C=C/c2ccccc2)CN1C |
| InChI | InChI=1S/C15H21N/c1-13-11-15(12-16(13)2)10-6-9-14-7-4-3-5-8-14/h3-9,13,15H,10-12H2,1-2H3/b9-6+/t13-,15-/m1/s1 |
| InChIKey | LOWTUJKWOGYWIP-LBMWNBJUSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |