C15H22NO+ — CID 7302647
(2S,6S)-2,6-dimethyl-4-[(E)-3-phenylprop-2-enyl]morpholin-4-ium (PubChem CID 7302647) has the molecular formula C15H22NO+ and a molecular weight of 232.35 g/mol. Its IUPAC name is (2S,6S)-2,6-dimethyl-4-[(E)-3-phenylprop-2-enyl]morpholin-4-ium.
| Compound Name | (2S,6S)-2,6-dimethyl-4-[(E)-3-phenylprop-2-enyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7302647 |
| Molecular Formula | C15H22NO+ |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (2S,6S)-2,6-dimethyl-4-[(E)-3-phenylprop-2-enyl]morpholin-4-ium |
| SMILES | C[C@H]1C[NH+](C/C=C/c2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H21NO/c1-13-11-16(12-14(2)17-13)10-6-9-15-7-4-3-5-8-15/h3-9,13-14H,10-12H2,1-2H3/p+1/b9-6+/t13-,14-/m0/s1 |
| InChIKey | MJSOKZQNFQUZPA-HXUSNMGPSA-O |
| XLogP | 1.39 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |