C14H22NOS+ — CID 7380571
(2R,6R)-2,6-dimethyl-4-(2-phenylsulfanylethyl)morpholin-4-ium (PubChem CID 7380571) has the molecular formula C14H22NOS+ and a molecular weight of 252.40 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-(2-phenylsulfanylethyl)morpholin-4-ium.
| Compound Name | (2R,6R)-2,6-dimethyl-4-(2-phenylsulfanylethyl)morpholin-4-ium |
|---|---|
| PubChem CID | 7380571 |
| Molecular Formula | C14H22NOS+ |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-(2-phenylsulfanylethyl)morpholin-4-ium |
| SMILES | C[C@@H]1C[NH+](CCSc2ccccc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C14H21NOS/c1-12-10-15(11-13(2)16-12)8-9-17-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3/p+1/t12-,13-/m1/s1 |
| InChIKey | PUEXDBWZCWWBQD-CHWSQXEVSA-O |
| XLogP | 1.47 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |