C16H25ClNO2S+ — CID 2182894
(2S,6S)-4-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-2,6-dimethylmorpholin-4-ium (PubChem CID 2182894) has the molecular formula C16H25ClNO2S+ and a molecular weight of 330.90 g/mol. Its IUPAC name is (2S,6S)-4-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-2,6-dimethylmorpholin-4-ium.
| Compound Name | (2S,6S)-4-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-2,6-dimethylmorpholin-4-ium |
|---|---|
| PubChem CID | 2182894 |
| Molecular Formula | C16H25ClNO2S+ |
| Molecular Weight | 330.90 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2S,6S)-4-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-2,6-dimethylmorpholin-4-ium |
| SMILES | C[C@H]1C[NH+](CCOCCSc2ccc(Cl)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C16H24ClNO2S/c1-13-11-18(12-14(2)20-13)7-8-19-9-10-21-16-5-3-15(17)4-6-16/h3-6,13-14H,7-12H2,1-2H3/p+1/t13-,14-/m0/s1 |
| InChIKey | OOVLVMWSMGXCRD-KBPBESRZSA-O |
| XLogP | 2.14 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.90 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|