C17H27ClNOS+ — CID 2183575
(3S,5S)-1-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-3,5-dimethylpiperidin-1-ium (PubChem CID 2183575) has the molecular formula C17H27ClNOS+ and a molecular weight of 328.93 g/mol. Its IUPAC name is (3S,5S)-1-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-3,5-dimethylpiperidin-1-ium.
| Compound Name | (3S,5S)-1-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-3,5-dimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 2183575 |
| Molecular Formula | C17H27ClNOS+ |
| Molecular Weight | 328.93 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (3S,5S)-1-[2-[2-(4-chlorophenyl)sulfanylethoxy]ethyl]-3,5-dimethylpiperidin-1-ium |
| SMILES | C[C@H]1C[C@H](C)C[NH+](CCOCCSc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H26ClNOS/c1-14-11-15(2)13-19(12-14)7-8-20-9-10-21-17-5-3-16(18)4-6-17/h3-6,14-15H,7-13H2,1-2H3/p+1/t14-,15-/m0/s1 |
| InChIKey | SFMLQAVQSGBTMM-GJZGRUSLSA-O |
| XLogP | 3.01 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.93 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|