C16H26NO+ — CID 7410808
(3S,5S)-3,5-dimethyl-1-[2-(3-methylphenoxy)ethyl]piperidin-1-ium (PubChem CID 7410808) has the molecular formula C16H26NO+ and a molecular weight of 248.39 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-1-[2-(3-methylphenoxy)ethyl]piperidin-1-ium.
| Compound Name | (3S,5S)-3,5-dimethyl-1-[2-(3-methylphenoxy)ethyl]piperidin-1-ium |
|---|---|
| PubChem CID | 7410808 |
| Molecular Formula | C16H26NO+ |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-1-[2-(3-methylphenoxy)ethyl]piperidin-1-ium |
| SMILES | Cc1cccc(OCC[NH+]2C[C@@H](C)C[C@H](C)C2)c1 |
| InChI | InChI=1S/C16H25NO/c1-13-5-4-6-16(10-13)18-8-7-17-11-14(2)9-15(3)12-17/h4-6,10,14-15H,7-9,11-12H2,1-3H3/p+1/t14-,15-/m0/s1 |
| InChIKey | QQBAVMQRULVQPC-GJZGRUSLSA-O |
| XLogP | 1.93 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |