C15H23BrNO+ — CID 7410909
(3R,5R)-1-[2-(4-bromophenoxy)ethyl]-3,5-dimethylpiperidin-1-ium (PubChem CID 7410909) has the molecular formula C15H23BrNO+ and a molecular weight of 313.26 g/mol. Its IUPAC name is (3R,5R)-1-[2-(4-bromophenoxy)ethyl]-3,5-dimethylpiperidin-1-ium.
| Compound Name | (3R,5R)-1-[2-(4-bromophenoxy)ethyl]-3,5-dimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 7410909 |
| Molecular Formula | C15H23BrNO+ |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (3R,5R)-1-[2-(4-bromophenoxy)ethyl]-3,5-dimethylpiperidin-1-ium |
| SMILES | C[C@@H]1C[C@@H](C)C[NH+](CCOc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C15H22BrNO/c1-12-9-13(2)11-17(10-12)7-8-18-15-5-3-14(16)4-6-15/h3-6,12-13H,7-11H2,1-2H3/p+1/t12-,13-/m1/s1 |
| InChIKey | ASINSSNRTKKCSK-CHWSQXEVSA-O |
| XLogP | 2.39 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |