C17H28NOS+ — CID 7285533
(3S,5S)-3,5-dimethyl-1-[2-(2-phenylsulfanylethoxy)ethyl]piperidin-1-ium (PubChem CID 7285533) has the molecular formula C17H28NOS+ and a molecular weight of 294.48 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-1-[2-(2-phenylsulfanylethoxy)ethyl]piperidin-1-ium.
| Compound Name | (3S,5S)-3,5-dimethyl-1-[2-(2-phenylsulfanylethoxy)ethyl]piperidin-1-ium |
|---|---|
| PubChem CID | 7285533 |
| Molecular Formula | C17H28NOS+ |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-1-[2-(2-phenylsulfanylethoxy)ethyl]piperidin-1-ium |
| SMILES | C[C@H]1C[C@H](C)C[NH+](CCOCCSc2ccccc2)C1 |
| InChI | InChI=1S/C17H27NOS/c1-15-12-16(2)14-18(13-15)8-9-19-10-11-20-17-6-4-3-5-7-17/h3-7,15-16H,8-14H2,1-2H3/p+1/t15-,16-/m0/s1 |
| InChIKey | RHUQQLBVJSNVLJ-HOTGVXAUSA-O |
| XLogP | 2.36 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|