C21H28NO+ — CID 7410857
(3S,5S)-3,5-dimethyl-1-[2-(2-phenylphenoxy)ethyl]piperidin-1-ium (PubChem CID 7410857) has the molecular formula C21H28NO+ and a molecular weight of 310.46 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-1-[2-(2-phenylphenoxy)ethyl]piperidin-1-ium.
| Compound Name | (3S,5S)-3,5-dimethyl-1-[2-(2-phenylphenoxy)ethyl]piperidin-1-ium |
|---|---|
| PubChem CID | 7410857 |
| Molecular Formula | C21H28NO+ |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-1-[2-(2-phenylphenoxy)ethyl]piperidin-1-ium |
| SMILES | C[C@H]1C[C@H](C)C[NH+](CCOc2ccccc2-c2ccccc2)C1 |
| InChI | InChI=1S/C21H27NO/c1-17-14-18(2)16-22(15-17)12-13-23-21-11-7-6-10-20(21)19-8-4-3-5-9-19/h3-11,17-18H,12-16H2,1-2H3/p+1/t17-,18-/m0/s1 |
| InChIKey | PIIJMQPDMDUIKD-ROUUACIJSA-O |
| XLogP | 3.29 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |