C21H30NO2+ — CID 7411201
(3R,5R)-3,5-dimethyl-1-[2-(2-naphthalen-1-yloxyethoxy)ethyl]piperidin-1-ium (PubChem CID 7411201) has the molecular formula C21H30NO2+ and a molecular weight of 328.48 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethyl-1-[2-(2-naphthalen-1-yloxyethoxy)ethyl]piperidin-1-ium.
| Compound Name | (3R,5R)-3,5-dimethyl-1-[2-(2-naphthalen-1-yloxyethoxy)ethyl]piperidin-1-ium |
|---|---|
| PubChem CID | 7411201 |
| Molecular Formula | C21H30NO2+ |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (3R,5R)-3,5-dimethyl-1-[2-(2-naphthalen-1-yloxyethoxy)ethyl]piperidin-1-ium |
| SMILES | C[C@@H]1C[C@@H](C)C[NH+](CCOCCOc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C21H29NO2/c1-17-14-18(2)16-22(15-17)10-11-23-12-13-24-21-9-5-7-19-6-3-4-8-20(19)21/h3-9,17-18H,10-16H2,1-2H3/p+1/t17-,18-/m1/s1 |
| InChIKey | WRHRLSUFTVSSCS-QZTJIDSGSA-O |
| XLogP | 2.80 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|