C18H25O8P — CID 122611590
2-[2-[2-(2-naphthalen-1-yloxyethoxy)ethoxy]ethoxy]ethyl dihydrogen phosphate (PubChem CID 122611590) has the molecular formula C18H25O8P and a molecular weight of 400.36 g/mol. Its IUPAC name is 2-[2-[2-(2-naphthalen-1-yloxyethoxy)ethoxy]ethoxy]ethyl dihydrogen phosphate.
| Compound Name | 2-[2-[2-(2-naphthalen-1-yloxyethoxy)ethoxy]ethoxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 122611590 |
| Molecular Formula | C18H25O8P |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-[2-[2-(2-naphthalen-1-yloxyethoxy)ethoxy]ethoxy]ethyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCCOCCOCCOCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C18H25O8P/c19-27(20,21)26-15-13-24-11-9-22-8-10-23-12-14-25-18-7-3-5-16-4-1-2-6-17(16)18/h1-7H,8-15H2,(H2,19,20,21) |
| InChIKey | PSSBRMQUXHUNPL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|