C16H21O5P — CID 174803088
2-(2-ethoxyethoxy)ethyl-naphthalen-1-yloxyphosphinic acid (PubChem CID 174803088) has the molecular formula C16H21O5P and a molecular weight of 324.31 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl-naphthalen-1-yloxyphosphinic acid.
| Compound Name | 2-(2-ethoxyethoxy)ethyl-naphthalen-1-yloxyphosphinic acid |
|---|---|
| PubChem CID | 174803088 |
| Molecular Formula | C16H21O5P |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl-naphthalen-1-yloxyphosphinic acid |
| SMILES | CCOCCOCCP(=O)(O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C16H21O5P/c1-2-19-10-11-20-12-13-22(17,18)21-16-9-5-7-14-6-3-4-8-15(14)16/h3-9H,2,10-13H2,1H3,(H,17,18) |
| InChIKey | NVWVIONFBQZASD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|