C23H35O8P — CID 122610959
2-[2-[2-(2-naphthalen-1-yloxyethoxy)ethoxy]ethoxy]ethyl pentyl hydrogen phosphate (PubChem CID 122610959) has the molecular formula C23H35O8P and a molecular weight of 470.50 g/mol. Its IUPAC name is 2-[2-[2-(2-naphthalen-1-yloxyethoxy)ethoxy]ethoxy]ethyl pentyl hydrogen phosphate.
| Compound Name | 2-[2-[2-(2-naphthalen-1-yloxyethoxy)ethoxy]ethoxy]ethyl pentyl hydrogen phosphate |
|---|---|
| PubChem CID | 122610959 |
| Molecular Formula | C23H35O8P |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 2-[2-[2-(2-naphthalen-1-yloxyethoxy)ethoxy]ethoxy]ethyl pentyl hydrogen phosphate |
| SMILES | CCCCCOP(=O)(O)OCCOCCOCCOCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C23H35O8P/c1-2-3-6-12-30-32(24,25)31-20-18-28-16-14-26-13-15-27-17-19-29-23-11-7-9-21-8-4-5-10-22(21)23/h4-5,7-11H,2-3,6,12-20H2,1H3,(H,24,25) |
| InChIKey | LGPOQZXBWAYGPS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|