C21H31O7P — CID 152717239
2-[2-(2-naphthalen-1-yloxyheptoxy)ethoxy]ethyl dihydrogen phosphate (PubChem CID 152717239) has the molecular formula C21H31O7P and a molecular weight of 426.45 g/mol. Its IUPAC name is 2-[2-(2-naphthalen-1-yloxyheptoxy)ethoxy]ethyl dihydrogen phosphate.
| Compound Name | 2-[2-(2-naphthalen-1-yloxyheptoxy)ethoxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 152717239 |
| Molecular Formula | C21H31O7P |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[2-(2-naphthalen-1-yloxyheptoxy)ethoxy]ethyl dihydrogen phosphate |
| SMILES | CCCCCC(COCCOCCOP(=O)(O)O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C21H31O7P/c1-2-3-4-10-19(17-26-14-13-25-15-16-27-29(22,23)24)28-21-12-7-9-18-8-5-6-11-20(18)21/h5-9,11-12,19H,2-4,10,13-17H2,1H3,(H2,22,23,24) |
| InChIKey | ZUWAYIGFNZSUQP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|