C34H56O9P2 — CID 139670579
bis(2-phenoxyundecyl) phosphono phosphate (PubChem CID 139670579) has the molecular formula C34H56O9P2 and a molecular weight of 670.76 g/mol. Its IUPAC name is bis(2-phenoxyundecyl) phosphono phosphate.
| Compound Name | bis(2-phenoxyundecyl) phosphono phosphate |
|---|---|
| PubChem CID | 139670579 |
| Molecular Formula | C34H56O9P2 |
| Molecular Weight | 670.76 g/mol |
| Exact Mass | 670.34 |
| IUPAC Name | bis(2-phenoxyundecyl) phosphono phosphate |
| SMILES | CCCCCCCCCC(COP(=O)(OCC(CCCCCCCCC)Oc1ccccc1)OP(=O)(O)O)Oc1ccccc1 |
| InChI | InChI=1S/C34H56O9P2/c1-3-5-7-9-11-13-17-27-33(41-31-23-19-15-20-24-31)29-39-45(38,43-44(35,36)37)40-30-34(42-32-25-21-16-22-26-32)28-18-14-12-10-8-6-4-2/h15-16,19-26,33-34H,3-14,17-18,27-30H2,1-2H3,(H2,35,36,37) |
| InChIKey | XTTATTLCVIKQDW-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.76 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|