C16H25FNO2+ — CID 2182374
(3S)-1-[2-[2-(2-fluorophenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium (PubChem CID 2182374) has the molecular formula C16H25FNO2+ and a molecular weight of 282.38 g/mol. Its IUPAC name is (3S)-1-[2-[2-(2-fluorophenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium.
| Compound Name | (3S)-1-[2-[2-(2-fluorophenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 2182374 |
| Molecular Formula | C16H25FNO2+ |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (3S)-1-[2-[2-(2-fluorophenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium |
| SMILES | C[C@H]1CCC[NH+](CCOCCOc2ccccc2F)C1 |
| InChI | InChI=1S/C16H24FNO2/c1-14-5-4-8-18(13-14)9-10-19-11-12-20-16-7-3-2-6-15(16)17/h2-3,6-7,14H,4-5,8-13H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | XBXOBEOHVSQKGU-AWEZNQCLSA-O |
| XLogP | 1.54 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|