C16H24NO3+ — CID 7394819
3-methoxy-2-[2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethoxy]benzaldehyde (PubChem CID 7394819) has the molecular formula C16H24NO3+ and a molecular weight of 278.37 g/mol. Its IUPAC name is 3-methoxy-2-[2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethoxy]benzaldehyde.
| Compound Name | 3-methoxy-2-[2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 7394819 |
| Molecular Formula | C16H24NO3+ |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 3-methoxy-2-[2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethoxy]benzaldehyde |
| SMILES | COc1cccc(C=O)c1OCC[NH+]1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C16H23NO3/c1-13-5-4-8-17(11-13)9-10-20-16-14(12-18)6-3-7-15(16)19-2/h3,6-7,12-13H,4-5,8-11H2,1-2H3/p+1/t13-/m1/s1 |
| InChIKey | YQYKMDDGMPMRAN-CYBMUJFWSA-O |
| XLogP | 1.20 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|